C16H16Cl2N2O4S2 — CID 17491121
2-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 17491121) has the molecular formula C16H16Cl2N2O4S2 and a molecular weight of 435.35 g/mol. Its IUPAC name is 2-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17491121 |
| Molecular Formula | C16H16Cl2N2O4S2 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | 2-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCO1)c1ccccc1NS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C16H16Cl2N2O4S2/c17-14-8-13(15(18)25-14)26(22,23)20-12-6-2-1-5-11(12)16(21)19-9-10-4-3-7-24-10/h1-2,5-6,8,10,20H,3-4,7,9H2,(H,19,21) |
| InChIKey | WBNTVRSEGPRTAJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |