C18H20N2O4S — CID 2981527
2-(benzenesulfonamido)-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 2981527) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-(benzenesulfonamido)-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 2981527 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-(benzenesulfonamido)-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCO1)c1ccccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O4S/c21-18(19-13-14-7-6-12-24-14)16-10-4-5-11-17(16)20-25(22,23)15-8-2-1-3-9-15/h1-5,8-11,14,20H,6-7,12-13H2,(H,19,21) |
| InChIKey | UHQYJGQTIVPCBJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |