C21H24N2O6S — CID 51515581
3,4-dimethyl-5-[[2-[[(2R)-oxolan-2-yl]methylcarbamoyl]phenyl]sulfamoyl]benzoic acid (PubChem CID 51515581) has the molecular formula C21H24N2O6S and a molecular weight of 432.50 g/mol. Its IUPAC name is 3,4-dimethyl-5-[[2-[[(2R)-oxolan-2-yl]methylcarbamoyl]phenyl]sulfamoyl]benzoic acid.
| Compound Name | 3,4-dimethyl-5-[[2-[[(2R)-oxolan-2-yl]methylcarbamoyl]phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 51515581 |
| Molecular Formula | C21H24N2O6S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 3,4-dimethyl-5-[[2-[[(2R)-oxolan-2-yl]methylcarbamoyl]phenyl]sulfamoyl]benzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)Nc2ccccc2C(=O)NC[C@H]2CCCO2)c1C |
| InChI | InChI=1S/C21H24N2O6S/c1-13-10-15(21(25)26)11-19(14(13)2)30(27,28)23-18-8-4-3-7-17(18)20(24)22-12-16-6-5-9-29-16/h3-4,7-8,10-11,16,23H,5-6,9,12H2,1-2H3,(H,22,24)(H,25,26)/t16-/m1/s1 |
| InChIKey | FBNIEKKQVJRICV-MRXNPFEDSA-N |
| XLogP | 2.71 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |