C15H21NO4 — CID 46418634
2-(2,4-dimethoxyphenyl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 46418634) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 46418634 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCC2CCCO2)c(OC)c1 |
| InChI | InChI=1S/C15H21NO4/c1-18-12-6-5-11(14(9-12)19-2)8-15(17)16-10-13-4-3-7-20-13/h5-6,9,13H,3-4,7-8,10H2,1-2H3,(H,16,17) |
| InChIKey | JBYIQFMNAFUQQB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |