C14H20N2O4 — CID 47194992
1-(2,5-dimethoxyphenyl)-3-(oxolan-2-ylmethyl)urea (PubChem CID 47194992) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-(oxolan-2-ylmethyl)urea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 47194992 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-(oxolan-2-ylmethyl)urea |
| SMILES | COc1ccc(OC)c(NC(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C14H20N2O4/c1-18-10-5-6-13(19-2)12(8-10)16-14(17)15-9-11-4-3-7-20-11/h5-6,8,11H,3-4,7,9H2,1-2H3,(H2,15,16,17) |
| InChIKey | ZJOGAROASFQPCX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |