C15H22N2O6S — CID 112991374
2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 112991374) has the molecular formula C15H22N2O6S and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 112991374 |
| Molecular Formula | C15H22N2O6S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)sulfonylamino]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(=O)NCC2CCCO2)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O6S/c1-21-11-5-6-14(13(8-11)22-2)24(19,20)17-10-15(18)16-9-12-4-3-7-23-12/h5-6,8,12,17H,3-4,7,9-10H2,1-2H3,(H,16,18) |
| InChIKey | WAJOBFBVHQDBCP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |