C17H25NO5 — CID 84556231
4-(2,4-dimethoxyphenyl)-4-hydroxy-N-(oxolan-2-ylmethyl)butanamide (PubChem CID 84556231) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-4-hydroxy-N-(oxolan-2-ylmethyl)butanamide.
| Compound Name | 4-(2,4-dimethoxyphenyl)-4-hydroxy-N-(oxolan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 84556231 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-4-hydroxy-N-(oxolan-2-ylmethyl)butanamide |
| SMILES | COc1ccc(C(O)CCC(=O)NCC2CCCO2)c(OC)c1 |
| InChI | InChI=1S/C17H25NO5/c1-21-12-5-6-14(16(10-12)22-2)15(19)7-8-17(20)18-11-13-4-3-9-23-13/h5-6,10,13,15,19H,3-4,7-9,11H2,1-2H3,(H,18,20) |
| InChIKey | UDOJIOCDFFJYRW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |