C17H27NO5 — CID 84556248
4-(2,4-dimethoxyphenyl)-N-(3-ethoxypropyl)-4-hydroxybutanamide (PubChem CID 84556248) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-N-(3-ethoxypropyl)-4-hydroxybutanamide.
| Compound Name | 4-(2,4-dimethoxyphenyl)-N-(3-ethoxypropyl)-4-hydroxybutanamide |
|---|---|
| PubChem CID | 84556248 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-N-(3-ethoxypropyl)-4-hydroxybutanamide |
| SMILES | CCOCCCNC(=O)CCC(O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C17H27NO5/c1-4-23-11-5-10-18-17(20)9-8-15(19)14-7-6-13(21-2)12-16(14)22-3/h6-7,12,15,19H,4-5,8-11H2,1-3H3,(H,18,20) |
| InChIKey | XQTFVWJVXYLSAU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|