C14H22O5 — CID 102927728
1-(2,4-dimethoxyphenyl)-3-(2-methoxyethoxy)propan-1-ol (PubChem CID 102927728) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-(2-methoxyethoxy)propan-1-ol.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-(2-methoxyethoxy)propan-1-ol |
|---|---|
| PubChem CID | 102927728 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-(2-methoxyethoxy)propan-1-ol |
| SMILES | COCCOCCC(O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C14H22O5/c1-16-8-9-19-7-6-13(15)12-5-4-11(17-2)10-14(12)18-3/h4-5,10,13,15H,6-9H2,1-3H3 |
| InChIKey | XLFDFXLKFOYRNI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|