C11H13NO3 — CID 5163746
3-(2,4-dimethoxyphenyl)-3-hydroxypropanenitrile (PubChem CID 5163746) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-3-hydroxypropanenitrile.
| Compound Name | 3-(2,4-dimethoxyphenyl)-3-hydroxypropanenitrile |
|---|---|
| PubChem CID | 5163746 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-3-hydroxypropanenitrile |
| SMILES | COc1ccc(C(O)CC#N)c(OC)c1 |
| InChI | InChI=1S/C11H13NO3/c1-14-8-3-4-9(10(13)5-6-12)11(7-8)15-2/h3-4,7,10,13H,5H2,1-2H3 |
| InChIKey | IUKWEGHGWPYGPX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |