C13H20O3S — CID 65131405
1-(2,4-dimethoxyphenyl)-2-propan-2-ylsulfanylethanol (PubChem CID 65131405) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-propan-2-ylsulfanylethanol.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-propan-2-ylsulfanylethanol |
|---|---|
| PubChem CID | 65131405 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-propan-2-ylsulfanylethanol |
| SMILES | COc1ccc(C(O)CSC(C)C)c(OC)c1 |
| InChI | InChI=1S/C13H20O3S/c1-9(2)17-8-12(14)11-6-5-10(15-3)7-13(11)16-4/h5-7,9,12,14H,8H2,1-4H3 |
| InChIKey | WIUQQXGUTGXPFV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |