C16H18O3S — CID 65141920
1-(2,4-dimethoxyphenyl)-2-phenylsulfanylethanol (PubChem CID 65141920) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-phenylsulfanylethanol.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-phenylsulfanylethanol |
|---|---|
| PubChem CID | 65141920 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-phenylsulfanylethanol |
| SMILES | COc1ccc(C(O)CSc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C16H18O3S/c1-18-12-8-9-14(16(10-12)19-2)15(17)11-20-13-6-4-3-5-7-13/h3-10,15,17H,11H2,1-2H3 |
| InChIKey | QLRSZETZIMTRAO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |