C12H19NO3 — CID 112507580
4-amino-1-(2,4-dimethoxyphenyl)butan-1-ol (PubChem CID 112507580) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 4-amino-1-(2,4-dimethoxyphenyl)butan-1-ol.
| Compound Name | 4-amino-1-(2,4-dimethoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 112507580 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 4-amino-1-(2,4-dimethoxyphenyl)butan-1-ol |
| SMILES | COc1ccc(C(O)CCCN)c(OC)c1 |
| InChI | InChI=1S/C12H19NO3/c1-15-9-5-6-10(12(8-9)16-2)11(14)4-3-7-13/h5-6,8,11,14H,3-4,7,13H2,1-2H3 |
| InChIKey | LCMHVXOPMNVILJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |