C12H16F2O4 — CID 82007414
2-(2,2-difluoroethoxy)-1-(2,4-dimethoxyphenyl)ethanol (PubChem CID 82007414) has the molecular formula C12H16F2O4 and a molecular weight of 262.25 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-1-(2,4-dimethoxyphenyl)ethanol.
| Compound Name | 2-(2,2-difluoroethoxy)-1-(2,4-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 82007414 |
| Molecular Formula | C12H16F2O4 |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-1-(2,4-dimethoxyphenyl)ethanol |
| SMILES | COc1ccc(C(O)COCC(F)F)c(OC)c1 |
| InChI | InChI=1S/C12H16F2O4/c1-16-8-3-4-9(11(5-8)17-2)10(15)6-18-7-12(13)14/h3-5,10,12,15H,6-7H2,1-2H3 |
| InChIKey | HLOQECNKHKKDHA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |