C15H19N3O4 — CID 84555446
4-(2,4-dimethoxyphenyl)-4-hydroxy-N-(1H-pyrazol-5-yl)butanamide (PubChem CID 84555446) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-4-hydroxy-N-(1H-pyrazol-5-yl)butanamide.
| Compound Name | 4-(2,4-dimethoxyphenyl)-4-hydroxy-N-(1H-pyrazol-5-yl)butanamide |
|---|---|
| PubChem CID | 84555446 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-4-hydroxy-N-(1H-pyrazol-5-yl)butanamide |
| SMILES | COc1ccc(C(O)CCC(=O)Nc2ccn[nH]2)c(OC)c1 |
| InChI | InChI=1S/C15H19N3O4/c1-21-10-3-4-11(13(9-10)22-2)12(19)5-6-15(20)17-14-7-8-16-18-14/h3-4,7-9,12,19H,5-6H2,1-2H3,(H2,16,17,18,20) |
| InChIKey | DQVUAWZFZXJXAY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |