C18H18Cl3NO4 — CID 84555209
4-(2,4-dimethoxyphenyl)-4-hydroxy-N-(2,4,6-trichlorophenyl)butanamide (PubChem CID 84555209) has the molecular formula C18H18Cl3NO4 and a molecular weight of 418.70 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-4-hydroxy-N-(2,4,6-trichlorophenyl)butanamide.
| Compound Name | 4-(2,4-dimethoxyphenyl)-4-hydroxy-N-(2,4,6-trichlorophenyl)butanamide |
|---|---|
| PubChem CID | 84555209 |
| Molecular Formula | C18H18Cl3NO4 |
| Molecular Weight | 418.70 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-4-hydroxy-N-(2,4,6-trichlorophenyl)butanamide |
| SMILES | COc1ccc(C(O)CCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C18H18Cl3NO4/c1-25-11-3-4-12(16(9-11)26-2)15(23)5-6-17(24)22-18-13(20)7-10(19)8-14(18)21/h3-4,7-9,15,23H,5-6H2,1-2H3,(H,22,24) |
| InChIKey | KLAOBQKOVKEVIB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |