C24H32N2O4 — CID 84555255
4-(2,4-dimethoxyphenyl)-4-hydroxy-N-[4-(4-methylpiperidin-1-yl)phenyl]butanamide (PubChem CID 84555255) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-4-hydroxy-N-[4-(4-methylpiperidin-1-yl)phenyl]butanamide.
| Compound Name | 4-(2,4-dimethoxyphenyl)-4-hydroxy-N-[4-(4-methylpiperidin-1-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 84555255 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-4-hydroxy-N-[4-(4-methylpiperidin-1-yl)phenyl]butanamide |
| SMILES | COc1ccc(C(O)CCC(=O)Nc2ccc(N3CCC(C)CC3)cc2)c(OC)c1 |
| InChI | InChI=1S/C24H32N2O4/c1-17-12-14-26(15-13-17)19-6-4-18(5-7-19)25-24(28)11-10-22(27)21-9-8-20(29-2)16-23(21)30-3/h4-9,16-17,22,27H,10-15H2,1-3H3,(H,25,28) |
| InChIKey | CSCAEFUZCGURPK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|