C22H29N3O4 — CID 108992539
1-[4-(4-methylpiperidin-1-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 108992539) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 1-[4-(4-methylpiperidin-1-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[4-(4-methylpiperidin-1-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 108992539 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 1-[4-(4-methylpiperidin-1-yl)phenyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2ccc(N3CCC(C)CC3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H29N3O4/c1-15-9-11-25(12-10-15)18-7-5-16(6-8-18)23-22(26)24-17-13-19(27-2)21(29-4)20(14-17)28-3/h5-8,13-15H,9-12H2,1-4H3,(H2,23,24,26) |
| InChIKey | KJHJEYSOYMMGAD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|