C21H25BrN2O2 — CID 3967891
5-bromo-2-methoxy-3-methyl-N-[4-(4-methylpiperidin-1-yl)phenyl]benzamide (PubChem CID 3967891) has the molecular formula C21H25BrN2O2 and a molecular weight of 417.35 g/mol. Its IUPAC name is 5-bromo-2-methoxy-3-methyl-N-[4-(4-methylpiperidin-1-yl)phenyl]benzamide.
| Compound Name | 5-bromo-2-methoxy-3-methyl-N-[4-(4-methylpiperidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 3967891 |
| Molecular Formula | C21H25BrN2O2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 5-bromo-2-methoxy-3-methyl-N-[4-(4-methylpiperidin-1-yl)phenyl]benzamide |
| SMILES | COc1c(C)cc(Br)cc1C(=O)Nc1ccc(N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C21H25BrN2O2/c1-14-8-10-24(11-9-14)18-6-4-17(5-7-18)23-21(25)19-13-16(22)12-15(2)20(19)26-3/h4-7,12-14H,8-11H2,1-3H3,(H,23,25) |
| InChIKey | FTJMDJCIGPYVNC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|