C20H23Br2N3O2 — CID 21216580
3,5-dibromo-N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-methoxybenzamide (PubChem CID 21216580) has the molecular formula C20H23Br2N3O2 and a molecular weight of 497.23 g/mol. Its IUPAC name is 3,5-dibromo-N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-methoxybenzamide.
| Compound Name | 3,5-dibromo-N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 21216580 |
| Molecular Formula | C20H23Br2N3O2 |
| Molecular Weight | 497.23 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | 3,5-dibromo-N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-methoxybenzamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3cc(Br)cc(Br)c3OC)cc2)CC1 |
| InChI | InChI=1S/C20H23Br2N3O2/c1-3-24-8-10-25(11-9-24)16-6-4-15(5-7-16)23-20(26)17-12-14(21)13-18(22)19(17)27-2/h4-7,12-13H,3,8-11H2,1-2H3,(H,23,26) |
| InChIKey | STSTXWTVKOXQRL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.23 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|