C18H18Br2IN3O — CID 4508199
3,5-dibromo-2-iodo-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide (PubChem CID 4508199) has the molecular formula C18H18Br2IN3O and a molecular weight of 579.07 g/mol. Its IUPAC name is 3,5-dibromo-2-iodo-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | 3,5-dibromo-2-iodo-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 4508199 |
| Molecular Formula | C18H18Br2IN3O |
| Molecular Weight | 579.07 g/mol |
| Exact Mass | 576.89 |
| IUPAC Name | 3,5-dibromo-2-iodo-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3cc(Br)cc(Br)c3I)cc2)CC1 |
| InChI | InChI=1S/C18H18Br2IN3O/c1-23-6-8-24(9-7-23)14-4-2-13(3-5-14)22-18(25)15-10-12(19)11-16(20)17(15)21/h2-5,10-11H,6-9H2,1H3,(H,22,25) |
| InChIKey | CNNFJBHEEXVMFA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.07 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|