C22H24Br2IN3O2 — CID 43913431
3,5-dibromo-2-iodo-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 43913431) has the molecular formula C22H24Br2IN3O2 and a molecular weight of 649.17 g/mol. Its IUPAC name is 3,5-dibromo-2-iodo-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 3,5-dibromo-2-iodo-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 43913431 |
| Molecular Formula | C22H24Br2IN3O2 |
| Molecular Weight | 649.17 g/mol |
| Exact Mass | 646.93 |
| IUPAC Name | 3,5-dibromo-2-iodo-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(NC(=O)c3cc(Br)cc(Br)c3I)cc2)CC1 |
| InChI | InChI=1S/C22H24Br2IN3O2/c1-14(2)11-20(29)28-9-7-27(8-10-28)17-5-3-16(4-6-17)26-22(30)18-12-15(23)13-19(24)21(18)25/h3-6,12-14H,7-11H2,1-2H3,(H,26,30) |
| InChIKey | OUZJRLXDJBYEAJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.17 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|