C22H25I2N3O2 — CID 43913640
2,5-diiodo-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 43913640) has the molecular formula C22H25I2N3O2 and a molecular weight of 617.27 g/mol. Its IUPAC name is 2,5-diiodo-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 2,5-diiodo-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 43913640 |
| Molecular Formula | C22H25I2N3O2 |
| Molecular Weight | 617.27 g/mol |
| Exact Mass | 617.00 |
| IUPAC Name | 2,5-diiodo-N-[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(NC(=O)c3cc(I)ccc3I)cc2)CC1 |
| InChI | InChI=1S/C22H25I2N3O2/c1-15(2)13-21(28)27-11-9-26(10-12-27)18-6-4-17(5-7-18)25-22(29)19-14-16(23)3-8-20(19)24/h3-8,14-15H,9-13H2,1-2H3,(H,25,29) |
| InChIKey | BAQHOQQJJXJMRD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.27 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|