C25H23ClIN3O2 — CID 1296484
2-chloro-5-iodo-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 1296484) has the molecular formula C25H23ClIN3O2 and a molecular weight of 559.84 g/mol. Its IUPAC name is 2-chloro-5-iodo-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 2-chloro-5-iodo-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 1296484 |
| Molecular Formula | C25H23ClIN3O2 |
| Molecular Weight | 559.84 g/mol |
| Exact Mass | 559.05 |
| IUPAC Name | 2-chloro-5-iodo-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)N2CCN(c3ccc(NC(=O)c4cc(I)ccc4Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H23ClIN3O2/c1-17-2-4-18(5-3-17)25(32)30-14-12-29(13-15-30)21-9-7-20(8-10-21)28-24(31)22-16-19(27)6-11-23(22)26/h2-11,16H,12-15H2,1H3,(H,28,31) |
| InChIKey | RVMJTCHKGDPVNZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.84 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|