C19H22N4OS — CID 50896011
[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]thiourea (PubChem CID 50896011) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is [4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]thiourea.
| Compound Name | [4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 50896011 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]thiourea |
| SMILES | Cc1ccc(C(=O)N2CCN(c3ccc(NC(N)=S)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H22N4OS/c1-14-2-4-15(5-3-14)18(24)23-12-10-22(11-13-23)17-8-6-16(7-9-17)21-19(20)25/h2-9H,10-13H2,1H3,(H3,20,21,25) |
| InChIKey | AWWZZPCBRVCDAH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|