C25H24BrN3O2 — CID 2215467
3-bromo-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 2215467) has the molecular formula C25H24BrN3O2 and a molecular weight of 478.39 g/mol. Its IUPAC name is 3-bromo-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 3-bromo-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 2215467 |
| Molecular Formula | C25H24BrN3O2 |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 3-bromo-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)N2CCN(c3ccc(NC(=O)c4cccc(Br)c4)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H24BrN3O2/c1-18-5-7-19(8-6-18)25(31)29-15-13-28(14-16-29)23-11-9-22(10-12-23)27-24(30)20-3-2-4-21(26)17-20/h2-12,17H,13-16H2,1H3,(H,27,30) |
| InChIKey | JWYUBMLGOJYWBT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|