C25H23BrClN3O3 — CID 17092737
3-bromo-N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 17092737) has the molecular formula C25H23BrClN3O3 and a molecular weight of 528.83 g/mol. Its IUPAC name is 3-bromo-N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 3-bromo-N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 17092737 |
| Molecular Formula | C25H23BrClN3O3 |
| Molecular Weight | 528.83 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | 3-bromo-N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCN(c2ccc(NC(=O)c3cccc(Br)c3)cc2)CC1 |
| InChI | InChI=1S/C25H23BrClN3O3/c1-33-23-10-5-19(27)16-22(23)25(32)30-13-11-29(12-14-30)21-8-6-20(7-9-21)28-24(31)17-3-2-4-18(26)15-17/h2-10,15-16H,11-14H2,1H3,(H,28,31) |
| InChIKey | MZXVXUKLRZCXFA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.83 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|