C29H24Cl3N3O4 — CID 17092855
N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 17092855) has the molecular formula C29H24Cl3N3O4 and a molecular weight of 584.89 g/mol. Its IUPAC name is N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17092855 |
| Molecular Formula | C29H24Cl3N3O4 |
| Molecular Weight | 584.89 g/mol |
| Exact Mass | 583.08 |
| IUPAC Name | N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCN(c2ccc(NC(=O)c3ccc(-c4ccc(Cl)c(Cl)c4)o3)cc2)CC1 |
| InChI | InChI=1S/C29H24Cl3N3O4/c1-38-26-9-3-19(30)17-22(26)29(37)35-14-12-34(13-15-35)21-6-4-20(5-7-21)33-28(36)27-11-10-25(39-27)18-2-8-23(31)24(32)16-18/h2-11,16-17H,12-15H2,1H3,(H,33,36) |
| InChIKey | MEGHWBYJVUCIKU-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.89 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|