C25H26ClN3O3 — CID 17111658
5-(3-chlorophenyl)-N-[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]furan-2-carboxamide (PubChem CID 17111658) has the molecular formula C25H26ClN3O3 and a molecular weight of 451.95 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]furan-2-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17111658 |
| Molecular Formula | C25H26ClN3O3 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 5-(3-chlorophenyl)-N-[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]furan-2-carboxamide |
| SMILES | CC(C)C(=O)N1CCN(c2ccc(NC(=O)c3ccc(-c4cccc(Cl)c4)o3)cc2)CC1 |
| InChI | InChI=1S/C25H26ClN3O3/c1-17(2)25(31)29-14-12-28(13-15-29)21-8-6-20(7-9-21)27-24(30)23-11-10-22(32-23)18-4-3-5-19(26)16-18/h3-11,16-17H,12-15H2,1-2H3,(H,27,30) |
| InChIKey | CXGXNQZEXJIELY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|