C32H29Cl2N3O4 — CID 17092837
(E)-N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide (PubChem CID 17092837) has the molecular formula C32H29Cl2N3O4 and a molecular weight of 590.51 g/mol. Its IUPAC name is (E)-N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17092837 |
| Molecular Formula | C32H29Cl2N3O4 |
| Molecular Weight | 590.51 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | (E)-N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCN(c2ccc(NC(=O)/C=C/c3ccc(-c4ccc(C)c(Cl)c4)o3)cc2)CC1 |
| InChI | InChI=1S/C32H29Cl2N3O4/c1-21-3-4-22(19-28(21)34)29-13-10-26(41-29)11-14-31(38)35-24-6-8-25(9-7-24)36-15-17-37(18-16-36)32(39)27-20-23(33)5-12-30(27)40-2/h3-14,19-20H,15-18H2,1-2H3,(H,35,38)/b14-11+ |
| InChIKey | CHIUJMZUMUCZHQ-SDNWHVSQSA-N |
| XLogP | 7.18 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.51 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|