C26H25Cl2N3O3 — CID 17117974
(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[4-(4-propanoylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 17117974) has the molecular formula C26H25Cl2N3O3 and a molecular weight of 498.41 g/mol. Its IUPAC name is (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[4-(4-propanoylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[4-(4-propanoylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17117974 |
| Molecular Formula | C26H25Cl2N3O3 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[4-(4-propanoylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | CCC(=O)N1CCN(c2ccc(NC(=O)/C=C/c3ccc(-c4ccc(Cl)cc4Cl)o3)cc2)CC1 |
| InChI | InChI=1S/C26H25Cl2N3O3/c1-2-26(33)31-15-13-30(14-16-31)20-6-4-19(5-7-20)29-25(32)12-9-21-8-11-24(34-21)22-10-3-18(27)17-23(22)28/h3-12,17H,2,13-16H2,1H3,(H,29,32)/b12-9+ |
| InChIKey | MIOZZLUUIVIRRT-FMIVXFBMSA-N |
| XLogP | 5.96 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|