C23H24Cl2N4O2S — CID 4264080
3-(2,4-dichlorophenyl)-N-[[4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 4264080) has the molecular formula C23H24Cl2N4O2S and a molecular weight of 491.44 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-[[4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-[[4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4264080 |
| Molecular Formula | C23H24Cl2N4O2S |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-[[4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | CCC(=O)N1CCN(c2ccc(NC(=S)NC(=O)C=Cc3ccc(Cl)cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C23H24Cl2N4O2S/c1-2-22(31)29-13-11-28(12-14-29)19-8-6-18(7-9-19)26-23(32)27-21(30)10-4-16-3-5-17(24)15-20(16)25/h3-10,15H,2,11-14H2,1H3,(H2,26,27,30,32) |
| InChIKey | GQBGBHWBKGSTIZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|