C21H22Cl2N3O2S+ — CID 2041498
(E)-3-(2,4-dichlorophenyl)-N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 2041498) has the molecular formula C21H22Cl2N3O2S+ and a molecular weight of 451.40 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 2041498 |
| Molecular Formula | C21H22Cl2N3O2S+ |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NC(=S)Nc1ccc(C[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C21H21Cl2N3O2S/c22-17-5-3-16(19(23)13-17)4-8-20(27)25-21(29)24-18-6-1-15(2-7-18)14-26-9-11-28-12-10-26/h1-8,13H,9-12,14H2,(H2,24,25,27,29)/p+1/b8-4+ |
| InChIKey | VRUPBUVZLPMGLT-XBXARRHUSA-O |
| XLogP | 2.93 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|