C20H19Cl2N3O2S — CID 1333113
N-[3-[3-(2,4-dichlorophenyl)prop-2-enoylcarbamothioylamino]phenyl]-2-methylpropanamide (PubChem CID 1333113) has the molecular formula C20H19Cl2N3O2S and a molecular weight of 436.36 g/mol. Its IUPAC name is N-[3-[3-(2,4-dichlorophenyl)prop-2-enoylcarbamothioylamino]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[3-(2,4-dichlorophenyl)prop-2-enoylcarbamothioylamino]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 1333113 |
| Molecular Formula | C20H19Cl2N3O2S |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | N-[3-[3-(2,4-dichlorophenyl)prop-2-enoylcarbamothioylamino]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cccc(NC(=S)NC(=O)C=Cc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N3O2S/c1-12(2)19(27)23-15-4-3-5-16(11-15)24-20(28)25-18(26)9-7-13-6-8-14(21)10-17(13)22/h3-12H,1-2H3,(H,23,27)(H2,24,25,26,28) |
| InChIKey | GBXUUHCEVXOIEU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|