C17H14Cl2N2O2S — CID 1344675
3-(2,4-dichlorophenyl)-N-[(2-hydroxy-5-methylphenyl)carbamothioyl]prop-2-enamide (PubChem CID 1344675) has the molecular formula C17H14Cl2N2O2S and a molecular weight of 381.28 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-[(2-hydroxy-5-methylphenyl)carbamothioyl]prop-2-enamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-[(2-hydroxy-5-methylphenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 1344675 |
| Molecular Formula | C17H14Cl2N2O2S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-[(2-hydroxy-5-methylphenyl)carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc(O)c(NC(=S)NC(=O)C=Cc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H14Cl2N2O2S/c1-10-2-6-15(22)14(8-10)20-17(24)21-16(23)7-4-11-3-5-12(18)9-13(11)19/h2-9,22H,1H3,(H2,20,21,23,24) |
| InChIKey | XCYBHYVSOZPRFP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|