C18H15Cl2IN2OS — CID 17115431
(E)-3-(2,4-dichlorophenyl)-N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]prop-2-enamide (PubChem CID 17115431) has the molecular formula C18H15Cl2IN2OS and a molecular weight of 505.21 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17115431 |
| Molecular Formula | C18H15Cl2IN2OS |
| Molecular Weight | 505.21 g/mol |
| Exact Mass | 503.93 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]prop-2-enamide |
| SMILES | Cc1cc(NC(=S)NC(=O)/C=C/c2ccc(Cl)cc2Cl)c(C)cc1I |
| InChI | InChI=1S/C18H15Cl2IN2OS/c1-10-8-16(11(2)7-15(10)21)22-18(25)23-17(24)6-4-12-3-5-13(19)9-14(12)20/h3-9H,1-2H3,(H2,22,23,24,25)/b6-4+ |
| InChIKey | GGYFZLUDGKAHIY-GQCTYLIASA-N |
| XLogP | 5.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.21 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|