C17H11Cl2IN2O3S — CID 6294188
2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]carbamothioylamino]-5-iodobenzoic acid (PubChem CID 6294188) has the molecular formula C17H11Cl2IN2O3S and a molecular weight of 521.16 g/mol. Its IUPAC name is 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]carbamothioylamino]-5-iodobenzoic acid.
| Compound Name | 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]carbamothioylamino]-5-iodobenzoic acid |
|---|---|
| PubChem CID | 6294188 |
| Molecular Formula | C17H11Cl2IN2O3S |
| Molecular Weight | 521.16 g/mol |
| Exact Mass | 519.89 |
| IUPAC Name | 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]carbamothioylamino]-5-iodobenzoic acid |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NC(=S)Nc1ccc(I)cc1C(=O)O |
| InChI | InChI=1S/C17H11Cl2IN2O3S/c18-10-3-1-9(13(19)7-10)2-6-15(23)22-17(26)21-14-5-4-11(20)8-12(14)16(24)25/h1-8H,(H,24,25)(H2,21,22,23,26)/b6-2+ |
| InChIKey | GXBDDPBAGQVHTI-QHHAFSJGSA-N |
| XLogP | 4.82 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.16 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|