C17H12Cl3N3O2S — CID 6126200
(E)-N-[[(4-chlorobenzoyl)amino]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 6126200) has the molecular formula C17H12Cl3N3O2S and a molecular weight of 428.73 g/mol. Its IUPAC name is (E)-N-[[(4-chlorobenzoyl)amino]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[(4-chlorobenzoyl)amino]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6126200 |
| Molecular Formula | C17H12Cl3N3O2S |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | (E)-N-[[(4-chlorobenzoyl)amino]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NC(=S)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12Cl3N3O2S/c18-12-5-2-11(3-6-12)16(25)22-23-17(26)21-15(24)8-4-10-1-7-13(19)9-14(10)20/h1-9H,(H,22,25)(H2,21,23,24,26)/b8-4+ |
| InChIKey | OAOMILGBIDJWRE-XBXARRHUSA-N |
| XLogP | 4.00 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|