C24H25ClN4O3S — CID 4510040
N-[4-[[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]carbamoyl]phenyl]cyclohexanecarboxamide (PubChem CID 4510040) has the molecular formula C24H25ClN4O3S and a molecular weight of 485.01 g/mol. Its IUPAC name is N-[4-[[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]carbamoyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]carbamoyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 4510040 |
| Molecular Formula | C24H25ClN4O3S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | N-[4-[[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]carbamoyl]phenyl]cyclohexanecarboxamide |
| SMILES | O=C(C=Cc1ccccc1Cl)NC(=S)NNC(=O)c1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H25ClN4O3S/c25-20-9-5-4-6-16(20)12-15-21(30)27-24(33)29-28-23(32)18-10-13-19(14-11-18)26-22(31)17-7-2-1-3-8-17/h4-6,9-15,17H,1-3,7-8H2,(H,26,31)(H,28,32)(H2,27,29,30,33) |
| InChIKey | BXUKVACXQGASOM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|