C22H22N4O4S — CID 5129481
N-[4-[[3-(2-methoxyphenyl)prop-2-enoylcarbamothioylamino]carbamoyl]phenyl]cyclopropanecarboxamide (PubChem CID 5129481) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is N-[4-[[3-(2-methoxyphenyl)prop-2-enoylcarbamothioylamino]carbamoyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[3-(2-methoxyphenyl)prop-2-enoylcarbamothioylamino]carbamoyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 5129481 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-[4-[[3-(2-methoxyphenyl)prop-2-enoylcarbamothioylamino]carbamoyl]phenyl]cyclopropanecarboxamide |
| SMILES | COc1ccccc1C=CC(=O)NC(=S)NNC(=O)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C22H22N4O4S/c1-30-18-5-3-2-4-14(18)10-13-19(27)24-22(31)26-25-21(29)16-8-11-17(12-9-16)23-20(28)15-6-7-15/h2-5,8-13,15H,6-7H2,1H3,(H,23,28)(H,25,29)(H2,24,26,27,31) |
| InChIKey | GEPMCCIYJKUJRJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|