C19H18N4O3S2 — CID 6301733
N-[4-[[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]cyclopropanecarboxamide (PubChem CID 6301733) has the molecular formula C19H18N4O3S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[4-[[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 6301733 |
| Molecular Formula | C19H18N4O3S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N-[4-[[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(/C=C/c1cccs1)NC(=S)NNC(=O)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C19H18N4O3S2/c24-16(10-9-15-2-1-11-28-15)21-19(27)23-22-18(26)13-5-7-14(8-6-13)20-17(25)12-3-4-12/h1-2,5-12H,3-4H2,(H,20,25)(H,22,26)(H2,21,23,24,27)/b10-9+ |
| InChIKey | RBHXTICZNRHAPX-MDZDMXLPSA-N |
| XLogP | 2.45 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|