C26H26N4O3S2 — CID 6274889
4-tert-butyl-N-[4-[[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]benzamide (PubChem CID 6274889) has the molecular formula C26H26N4O3S2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 6274889 |
| Molecular Formula | C26H26N4O3S2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 4-tert-butyl-N-[4-[[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(C(=O)NNC(=S)NC(=O)/C=C/c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O3S2/c1-26(2,3)19-10-6-17(7-11-19)23(32)27-20-12-8-18(9-13-20)24(33)29-30-25(34)28-22(31)15-14-21-5-4-16-35-21/h4-16H,1-3H3,(H,27,32)(H,29,33)(H2,28,30,31,34)/b15-14+ |
| InChIKey | WKRCHMIFBIWHCX-CCEZHUSRSA-N |
| XLogP | 4.65 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|