C22H19N3O3S — CID 3391223
2-methyl-N-[4-[(3-thiophen-2-ylprop-2-enoylamino)carbamoyl]phenyl]benzamide (PubChem CID 3391223) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-methyl-N-[4-[(3-thiophen-2-ylprop-2-enoylamino)carbamoyl]phenyl]benzamide.
| Compound Name | 2-methyl-N-[4-[(3-thiophen-2-ylprop-2-enoylamino)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 3391223 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-methyl-N-[4-[(3-thiophen-2-ylprop-2-enoylamino)carbamoyl]phenyl]benzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(C(=O)NNC(=O)C=Cc2cccs2)cc1 |
| InChI | InChI=1S/C22H19N3O3S/c1-15-5-2-3-7-19(15)22(28)23-17-10-8-16(9-11-17)21(27)25-24-20(26)13-12-18-6-4-14-29-18/h2-14H,1H3,(H,23,28)(H,24,26)(H,25,27) |
| InChIKey | TXROHBQQPYVLFY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|