C23H21N3O2S2 — CID 4944611
N-(3,4-dimethylphenyl)-2-(3-thiophen-2-ylprop-2-enoylcarbamothioylamino)benzamide (PubChem CID 4944611) has the molecular formula C23H21N3O2S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-(3-thiophen-2-ylprop-2-enoylcarbamothioylamino)benzamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-(3-thiophen-2-ylprop-2-enoylcarbamothioylamino)benzamide |
|---|---|
| PubChem CID | 4944611 |
| Molecular Formula | C23H21N3O2S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-(3-thiophen-2-ylprop-2-enoylcarbamothioylamino)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=S)NC(=O)C=Cc2cccs2)cc1C |
| InChI | InChI=1S/C23H21N3O2S2/c1-15-9-10-17(14-16(15)2)24-22(28)19-7-3-4-8-20(19)25-23(29)26-21(27)12-11-18-6-5-13-30-18/h3-14H,1-2H3,(H,24,28)(H2,25,26,27,29) |
| InChIKey | VIMXMCCKZNTFTM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|