C22H23N3O4S — CID 6234960
ethyl (E)-4-[[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]carbamothioylamino]-4-oxobut-2-enoate (PubChem CID 6234960) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is ethyl (E)-4-[[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]carbamothioylamino]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]carbamothioylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 6234960 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | ethyl (E)-4-[[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]carbamothioylamino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)NC(=S)Nc1ccccc1C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C22H23N3O4S/c1-4-29-20(27)12-11-19(26)25-22(30)24-18-8-6-5-7-17(18)21(28)23-16-10-9-14(2)15(3)13-16/h5-13H,4H2,1-3H3,(H,23,28)(H2,24,25,26,30)/b12-11+ |
| InChIKey | NOJMBQBMZUOTHE-VAWYXSNFSA-N |
| XLogP | 3.49 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|