C24H23N3O2S — CID 4944581
N-[[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]carbamothioyl]-2-methylbenzamide (PubChem CID 4944581) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]carbamothioyl]-2-methylbenzamide.
| Compound Name | N-[[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]carbamothioyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 4944581 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]carbamothioyl]-2-methylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=S)NC(=O)c2ccccc2C)cc1C |
| InChI | InChI=1S/C24H23N3O2S/c1-15-12-13-18(14-17(15)3)25-23(29)20-10-6-7-11-21(20)26-24(30)27-22(28)19-9-5-4-8-16(19)2/h4-14H,1-3H3,(H,25,29)(H2,26,27,28,30) |
| InChIKey | YIOFHQXRFIKXDI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|