C16H15IN2OS — CID 1048226
N-[(3,4-dimethylphenyl)carbamothioyl]-2-iodobenzamide (PubChem CID 1048226) has the molecular formula C16H15IN2OS and a molecular weight of 410.28 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)carbamothioyl]-2-iodobenzamide.
| Compound Name | N-[(3,4-dimethylphenyl)carbamothioyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 1048226 |
| Molecular Formula | C16H15IN2OS |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | N-[(3,4-dimethylphenyl)carbamothioyl]-2-iodobenzamide |
| SMILES | Cc1ccc(NC(=S)NC(=O)c2ccccc2I)cc1C |
| InChI | InChI=1S/C16H15IN2OS/c1-10-7-8-12(9-11(10)2)18-16(21)19-15(20)13-5-3-4-6-14(13)17/h3-9H,1-2H3,(H2,18,19,20,21) |
| InChIKey | RXFSRJSQVDKVCM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|