C20H16IN3O3S2 — CID 5177255
2-iodo-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 5177255) has the molecular formula C20H16IN3O3S2 and a molecular weight of 537.40 g/mol. Its IUPAC name is 2-iodo-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-iodo-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 5177255 |
| Molecular Formula | C20H16IN3O3S2 |
| Molecular Weight | 537.40 g/mol |
| Exact Mass | 536.97 |
| IUPAC Name | 2-iodo-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1)c1ccccc1I |
| InChI | InChI=1S/C20H16IN3O3S2/c21-18-9-5-4-8-17(18)19(25)23-20(28)22-14-10-12-16(13-11-14)29(26,27)24-15-6-2-1-3-7-15/h1-13,24H,(H2,22,23,25,28) |
| InChIKey | OTPNKBIAXMNGLD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|