C20H17IN2O3S — CID 1302991
2-iodo-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 1302991) has the molecular formula C20H17IN2O3S and a molecular weight of 492.34 g/mol. Its IUPAC name is 2-iodo-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 2-iodo-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 1302991 |
| Molecular Formula | C20H17IN2O3S |
| Molecular Weight | 492.34 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | 2-iodo-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(NC(=O)c3ccccc3I)cc2)c1 |
| InChI | InChI=1S/C20H17IN2O3S/c1-14-5-4-6-16(13-14)23-27(25,26)17-11-9-15(10-12-17)22-20(24)18-7-2-3-8-19(18)21/h2-13,23H,1H3,(H,22,24) |
| InChIKey | VJMAHDZVBZXUIG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|