C19H13Cl2IN2O3S — CID 126415096
N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-2-iodobenzamide (PubChem CID 126415096) has the molecular formula C19H13Cl2IN2O3S and a molecular weight of 547.20 g/mol. Its IUPAC name is N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-2-iodobenzamide.
| Compound Name | N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 126415096 |
| Molecular Formula | C19H13Cl2IN2O3S |
| Molecular Weight | 547.20 g/mol |
| Exact Mass | 545.91 |
| IUPAC Name | N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-2-iodobenzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2cc(Cl)cc(Cl)c2)cc1)c1ccccc1I |
| InChI | InChI=1S/C19H13Cl2IN2O3S/c20-12-9-13(21)11-15(10-12)24-28(26,27)16-7-5-14(6-8-16)23-19(25)17-3-1-2-4-18(17)22/h1-11,24H,(H,23,25) |
| InChIKey | PIXXTVRILIKCCC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.20 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|